C35H29NO4P2 — CID 170695122
3,4-bis(diphenylphosphoryl)-1-(4-methylphenyl)pyrrolidine-2,5-dione (PubChem CID 170695122) has the molecular formula C35H29NO4P2 and a molecular weight of 589.57 g/mol. Its IUPAC name is 3,4-bis(diphenylphosphoryl)-1-(4-methylphenyl)pyrrolidine-2,5-dione.
| Compound Name | 3,4-bis(diphenylphosphoryl)-1-(4-methylphenyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 170695122 |
| Molecular Formula | C35H29NO4P2 |
| Molecular Weight | 589.57 g/mol |
| Exact Mass | 589.16 |
| IUPAC Name | 3,4-bis(diphenylphosphoryl)-1-(4-methylphenyl)pyrrolidine-2,5-dione |
| SMILES | Cc1ccc(N2C(=O)C(P(=O)(c3ccccc3)c3ccccc3)C(P(=O)(c3ccccc3)c3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C35H29NO4P2/c1-26-22-24-27(25-23-26)36-34(37)32(41(39,28-14-6-2-7-15-28)29-16-8-3-9-17-29)33(35(36)38)42(40,30-18-10-4-11-19-30)31-20-12-5-13-21-31/h2-25,32-33H,1H3 |
| InChIKey | UMEDOAFNKNUEGU-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.57 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|