C24H26NOP — CID 164683445
2-diphenylphosphoryl-5-methyl-1-(4-methylphenyl)pyrrolidine (PubChem CID 164683445) has the molecular formula C24H26NOP and a molecular weight of 375.45 g/mol. Its IUPAC name is 2-diphenylphosphoryl-5-methyl-1-(4-methylphenyl)pyrrolidine.
| Compound Name | 2-diphenylphosphoryl-5-methyl-1-(4-methylphenyl)pyrrolidine |
|---|---|
| PubChem CID | 164683445 |
| Molecular Formula | C24H26NOP |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | 2-diphenylphosphoryl-5-methyl-1-(4-methylphenyl)pyrrolidine |
| SMILES | Cc1ccc(N2C(C)CCC2P(=O)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H26NOP/c1-19-13-16-21(17-14-19)25-20(2)15-18-24(25)27(26,22-9-5-3-6-10-22)23-11-7-4-8-12-23/h3-14,16-17,20,24H,15,18H2,1-2H3 |
| InChIKey | TZLXAZHOVBZNNQ-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|