C18H22NOP — CID 11087864
(5S)-5-diphenylphosphoryl-2,2-dimethylpyrrolidine (PubChem CID 11087864) has the molecular formula C18H22NOP and a molecular weight of 299.35 g/mol. Its IUPAC name is (5S)-5-diphenylphosphoryl-2,2-dimethylpyrrolidine.
| Compound Name | (5S)-5-diphenylphosphoryl-2,2-dimethylpyrrolidine |
|---|---|
| PubChem CID | 11087864 |
| Molecular Formula | C18H22NOP |
| Molecular Weight | 299.35 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | (5S)-5-diphenylphosphoryl-2,2-dimethylpyrrolidine |
| SMILES | CC1(C)CC[C@H](P(=O)(c2ccccc2)c2ccccc2)N1 |
| InChI | InChI=1S/C18H22NOP/c1-18(2)14-13-17(19-18)21(20,15-9-5-3-6-10-15)16-11-7-4-8-12-16/h3-12,17,19H,13-14H2,1-2H3/t17-/m0/s1 |
| InChIKey | YQFJNLMDDYTZSA-KRWDZBQOSA-N |
| XLogP | 3.49 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.35 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|