C16H16F2NO2P — CID 11850193
(2S,3S)-2-(difluoromethyl)-3-diphenylphosphoryl-2-methoxyaziridine (PubChem CID 11850193) has the molecular formula C16H16F2NO2P and a molecular weight of 323.28 g/mol. Its IUPAC name is (2S,3S)-2-(difluoromethyl)-3-diphenylphosphoryl-2-methoxyaziridine.
| Compound Name | (2S,3S)-2-(difluoromethyl)-3-diphenylphosphoryl-2-methoxyaziridine |
|---|---|
| PubChem CID | 11850193 |
| Molecular Formula | C16H16F2NO2P |
| Molecular Weight | 323.28 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | (2S,3S)-2-(difluoromethyl)-3-diphenylphosphoryl-2-methoxyaziridine |
| SMILES | CO[C@]1(C(F)F)N[C@H]1P(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C16H16F2NO2P/c1-21-16(14(17)18)15(19-16)22(20,12-8-4-2-5-9-12)13-10-6-3-7-11-13/h2-11,14-15,19H,1H3/t15-,16-/m0/s1 |
| InChIKey | SUUABPLVGZWYHM-HOTGVXAUSA-N |
| XLogP | 2.54 |
| TPSA | 48.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.28 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|