C23H29O2P — CID 102091488
(5R)-5-diphenylphosphoryl-1-ethoxy-6,6-dimethylcycloheptene (PubChem CID 102091488) has the molecular formula C23H29O2P and a molecular weight of 368.46 g/mol. Its IUPAC name is (5R)-5-diphenylphosphoryl-1-ethoxy-6,6-dimethylcycloheptene.
| Compound Name | (5R)-5-diphenylphosphoryl-1-ethoxy-6,6-dimethylcycloheptene |
|---|---|
| PubChem CID | 102091488 |
| Molecular Formula | C23H29O2P |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.19 |
| IUPAC Name | (5R)-5-diphenylphosphoryl-1-ethoxy-6,6-dimethylcycloheptene |
| SMILES | CCOC1=CCC[C@@H](P(=O)(c2ccccc2)c2ccccc2)C(C)(C)C1 |
| InChI | InChI=1S/C23H29O2P/c1-4-25-19-12-11-17-22(23(2,3)18-19)26(24,20-13-7-5-8-14-20)21-15-9-6-10-16-21/h5-10,12-16,22H,4,11,17-18H2,1-3H3/t22-/m1/s1 |
| InChIKey | UXKPQGPJNPKBGM-JOCHJYFZSA-N |
| XLogP | 5.50 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|