C32H32N2O2P2 — CID 102245840
2,5-bis(diphenylphosphoryl)-3,6-diethyl-2,5-dihydropyrazine (PubChem CID 102245840) has the molecular formula C32H32N2O2P2 and a molecular weight of 538.57 g/mol. Its IUPAC name is 2,5-bis(diphenylphosphoryl)-3,6-diethyl-2,5-dihydropyrazine.
| Compound Name | 2,5-bis(diphenylphosphoryl)-3,6-diethyl-2,5-dihydropyrazine |
|---|---|
| PubChem CID | 102245840 |
| Molecular Formula | C32H32N2O2P2 |
| Molecular Weight | 538.57 g/mol |
| Exact Mass | 538.19 |
| IUPAC Name | 2,5-bis(diphenylphosphoryl)-3,6-diethyl-2,5-dihydropyrazine |
| SMILES | CCC1=NC(P(=O)(c2ccccc2)c2ccccc2)C(CC)=NC1P(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C32H32N2O2P2/c1-3-29-31(37(35,25-17-9-5-10-18-25)26-19-11-6-12-20-26)34-30(4-2)32(33-29)38(36,27-21-13-7-14-22-27)28-23-15-8-16-24-28/h5-24,31-32H,3-4H2,1-2H3 |
| InChIKey | BZWRWUWTPZDASA-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.57 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|