C31H29OP — CID 102091489
(5R,6S)-5-diphenylphosphoryl-1,6-diphenylcycloheptene (PubChem CID 102091489) has the molecular formula C31H29OP and a molecular weight of 448.55 g/mol. Its IUPAC name is (5R,6S)-5-diphenylphosphoryl-1,6-diphenylcycloheptene.
| Compound Name | (5R,6S)-5-diphenylphosphoryl-1,6-diphenylcycloheptene |
|---|---|
| PubChem CID | 102091489 |
| Molecular Formula | C31H29OP |
| Molecular Weight | 448.55 g/mol |
| Exact Mass | 448.20 |
| IUPAC Name | (5R,6S)-5-diphenylphosphoryl-1,6-diphenylcycloheptene |
| SMILES | O=P(c1ccccc1)(c1ccccc1)[C@@H]1CCC=C(c2ccccc2)C[C@H]1c1ccccc1 |
| InChI | InChI=1S/C31H29OP/c32-33(28-19-9-3-10-20-28,29-21-11-4-12-22-29)31-23-13-18-27(25-14-5-1-6-15-25)24-30(31)26-16-7-2-8-17-26/h1-12,14-22,30-31H,13,23-24H2/t30-,31+/m0/s1 |
| InChIKey | DLTPGJPMRBMZAQ-IOWSJCHKSA-N |
| XLogP | 7.42 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.55 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|