About (5R,6S)-5-diphenylphosphoryl-1,6-diphenylcycloheptene
(5R,6S)-5-diphenylphosphoryl-1,6-diphenylcycloheptene (PubChem CID 102091489) has the molecular formula C31H29OP
and a molecular weight of 448.55 g/mol. Its IUPAC name is (5R,6S)-5-diphenylphosphoryl-1,6-diphenylcycloheptene.
Molecular Properties
| Compound Name | (5R,6S)-5-diphenylphosphoryl-1,6-diphenylcycloheptene |
| PubChem CID | 102091489 |
| Molecular Formula | C31H29OP |
| Molecular Weight | 448.55 g/mol |
| Exact Mass | 448.20 |
| IUPAC Name | (5R,6S)-5-diphenylphosphoryl-1,6-diphenylcycloheptene |
| SMILES | O=P(c1ccccc1)(c1ccccc1)[C@@H]1CCC=C(c2ccccc2)C[C@H]1c1ccccc1 |
| InChI | InChI=1S/C31H29OP/c32-33(28-19-9-3-10-20-28,29-21-11-4-12-22-29)31-23-13-18-27(25-14-5-1-6-15-25)24-30(31)26-16-7-2-8-17-26/h1-12,14-22,30-31H,13,23-24H2/t30-,31+/m0/s1 |
| InChIKey | DLTPGJPMRBMZAQ-IOWSJCHKSA-N |
| XLogP | 7.42 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 448.55 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (5R,6S)-5-diphenylphosphoryl-1,6-diphenylcycloheptene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5R,6S)-5-diphenylphosphoryl-1,6-diphenylcycloheptene?
The IUPAC name of (5R,6S)-5-diphenylphosphoryl-1,6-diphenylcycloheptene (CID 102091489) is (5R,6S)-5-diphenylphosphoryl-1,6-diphenylcycloheptene.
What is the SMILES notation for (5R,6S)-5-diphenylphosphoryl-1,6-diphenylcycloheptene?
The canonical SMILES for (5R,6S)-5-diphenylphosphoryl-1,6-diphenylcycloheptene is O=P(c1ccccc1)(c1ccccc1)[C@@H]1CCC=C(c2ccccc2)C[C@H]1c1ccccc1.
What is the InChIKey of (5R,6S)-5-diphenylphosphoryl-1,6-diphenylcycloheptene?
The InChIKey is DLTPGJPMRBMZAQ-IOWSJCHKSA-N. The full InChI is InChI=1S/C31H29OP/c32-33(28-19-9-3-10-20-28,29-21-11-4-12-22-29)31-23-13-18-27(25-14-5-1-6-15-25)24-30(31)26-16-7-2-8-17-26/h1-12,14-22,30-31H,13,23-24H2/t30-,31+/m0/s1.
What are the key properties of (5R,6S)-5-diphenylphosphoryl-1,6-diphenylcycloheptene?
(5R,6S)-5-diphenylphosphoryl-1,6-diphenylcycloheptene has a molecular weight of 448.55 g/mol, XLogP of 7.42, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (5R,6S)-5-diphenylphosphoryl-1,6-diphenylcycloheptene is sourced from PubChem (CID 102091489), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).