C31H29O3PTe — CID 135063103
(2S,3R)-2-diphenylphosphoryl-3,5-bis(4-methoxyphenyl)-3,4-dihydro-2H-telluropyran (PubChem CID 135063103) has the molecular formula C31H29O3PTe and a molecular weight of 608.14 g/mol. Its IUPAC name is (2S,3R)-2-diphenylphosphoryl-3,5-bis(4-methoxyphenyl)-3,4-dihydro-2H-telluropyran.
| Compound Name | (2S,3R)-2-diphenylphosphoryl-3,5-bis(4-methoxyphenyl)-3,4-dihydro-2H-telluropyran |
|---|---|
| PubChem CID | 135063103 |
| Molecular Formula | C31H29O3PTe |
| Molecular Weight | 608.14 g/mol |
| Exact Mass | 610.09 |
| IUPAC Name | (2S,3R)-2-diphenylphosphoryl-3,5-bis(4-methoxyphenyl)-3,4-dihydro-2H-telluropyran |
| SMILES | COc1ccc(C2=C[Te][C@H](P(=O)(c3ccccc3)c3ccccc3)[C@@H](c3ccc(OC)cc3)C2)cc1 |
| InChI | InChI=1S/C31H29O3PTe/c1-33-26-17-13-23(14-18-26)25-21-30(24-15-19-27(34-2)20-16-24)31(36-22-25)35(32,28-9-5-3-6-10-28)29-11-7-4-8-12-29/h3-20,22,30-31H,21H2,1-2H3/t30-,31+/m1/s1 |
| InChIKey | WXNQJHXXHIZLIC-JSOSNVBQSA-N |
| XLogP | 6.28 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.14 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|