C35H32O4 — CID 51722306
(E)-1-[(1S,2R,6R)-2-hydroxy-2,4-bis(4-methoxyphenyl)-6-phenylcyclohex-3-en-1-yl]-3-phenylprop-2-en-1-one (PubChem CID 51722306) has the molecular formula C35H32O4 and a molecular weight of 516.64 g/mol. Its IUPAC name is (E)-1-[(1S,2R,6R)-2-hydroxy-2,4-bis(4-methoxyphenyl)-6-phenylcyclohex-3-en-1-yl]-3-phenylprop-2-en-1-one.
| Compound Name | (E)-1-[(1S,2R,6R)-2-hydroxy-2,4-bis(4-methoxyphenyl)-6-phenylcyclohex-3-en-1-yl]-3-phenylprop-2-en-1-one |
|---|---|
| PubChem CID | 51722306 |
| Molecular Formula | C35H32O4 |
| Molecular Weight | 516.64 g/mol |
| Exact Mass | 516.23 |
| IUPAC Name | (E)-1-[(1S,2R,6R)-2-hydroxy-2,4-bis(4-methoxyphenyl)-6-phenylcyclohex-3-en-1-yl]-3-phenylprop-2-en-1-one |
| SMILES | COc1ccc(C2=C[C@](O)(c3ccc(OC)cc3)[C@@H](C(=O)/C=C/c3ccccc3)[C@H](c3ccccc3)C2)cc1 |
| InChI | InChI=1S/C35H32O4/c1-38-30-18-14-26(15-19-30)28-23-32(27-11-7-4-8-12-27)34(33(36)22-13-25-9-5-3-6-10-25)35(37,24-28)29-16-20-31(39-2)21-17-29/h3-22,24,32,34,37H,23H2,1-2H3/b22-13+/t32-,34+,35-/m0/s1 |
| InChIKey | WRBYXBXOFDTHRD-IACXWYQSSA-N |
| XLogP | 7.06 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.64 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|