C20H22O2 — CID 154712619
4-(4-methoxyphenyl)-6,6-dimethyl-2-phenyl-2,3-dihydropyran (PubChem CID 154712619) has the molecular formula C20H22O2 and a molecular weight of 294.39 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)-6,6-dimethyl-2-phenyl-2,3-dihydropyran.
| Compound Name | 4-(4-methoxyphenyl)-6,6-dimethyl-2-phenyl-2,3-dihydropyran |
|---|---|
| PubChem CID | 154712619 |
| Molecular Formula | C20H22O2 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | 4-(4-methoxyphenyl)-6,6-dimethyl-2-phenyl-2,3-dihydropyran |
| SMILES | COc1ccc(C2=CC(C)(C)OC(c3ccccc3)C2)cc1 |
| InChI | InChI=1S/C20H22O2/c1-20(2)14-17(15-9-11-18(21-3)12-10-15)13-19(22-20)16-7-5-4-6-8-16/h4-12,14,19H,13H2,1-3H3 |
| InChIKey | IRNPRTVXACLBBB-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |