C18H18O3 — CID 139648138
6-(4-methoxyphenyl)-2-phenyl-4,5-dihydro-1,3-dioxepine (PubChem CID 139648138) has the molecular formula C18H18O3 and a molecular weight of 282.34 g/mol. Its IUPAC name is 6-(4-methoxyphenyl)-2-phenyl-4,5-dihydro-1,3-dioxepine.
| Compound Name | 6-(4-methoxyphenyl)-2-phenyl-4,5-dihydro-1,3-dioxepine |
|---|---|
| PubChem CID | 139648138 |
| Molecular Formula | C18H18O3 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | 6-(4-methoxyphenyl)-2-phenyl-4,5-dihydro-1,3-dioxepine |
| SMILES | COc1ccc(C2=COC(c3ccccc3)OCC2)cc1 |
| InChI | InChI=1S/C18H18O3/c1-19-17-9-7-14(8-10-17)16-11-12-20-18(21-13-16)15-5-3-2-4-6-15/h2-10,13,18H,11-12H2,1H3 |
| InChIKey | LEGIZBLOMZWUDX-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |