C10H10O3 — CID 141045608
4-methoxy-2-phenyl-1,3-dioxole (PubChem CID 141045608) has the molecular formula C10H10O3 and a molecular weight of 178.19 g/mol. Its IUPAC name is 4-methoxy-2-phenyl-1,3-dioxole.
| Compound Name | 4-methoxy-2-phenyl-1,3-dioxole |
|---|---|
| PubChem CID | 141045608 |
| Molecular Formula | C10H10O3 |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.06 |
| IUPAC Name | 4-methoxy-2-phenyl-1,3-dioxole |
| SMILES | COC1=COC(c2ccccc2)O1 |
| InChI | InChI=1S/C10H10O3/c1-11-9-7-12-10(13-9)8-5-3-2-4-6-8/h2-7,10H,1H3 |
| InChIKey | FWBGVGNDZJWYBO-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |