C10H10O2 — CID 14792930
4-methyl-2-phenyl-1,3-dioxole (PubChem CID 14792930) has the molecular formula C10H10O2 and a molecular weight of 162.19 g/mol. Its IUPAC name is 4-methyl-2-phenyl-1,3-dioxole.
| Compound Name | 4-methyl-2-phenyl-1,3-dioxole |
|---|---|
| PubChem CID | 14792930 |
| Molecular Formula | C10H10O2 |
| Molecular Weight | 162.19 g/mol |
| Exact Mass | 162.07 |
| IUPAC Name | 4-methyl-2-phenyl-1,3-dioxole |
| SMILES | CC1=COC(c2ccccc2)O1 |
| InChI | InChI=1S/C10H10O2/c1-8-7-11-10(12-8)9-5-3-2-4-6-9/h2-7,10H,1H3 |
| InChIKey | ZAYFCCUBJYEXBE-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.19 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |