C26H32NO3+ — CID 102317524
(E)-1-[1-ethyl-4-hydroxy-1-methyl-4-[(E)-2-phenylethenyl]piperidin-1-ium-3-yl]-3-(4-methoxyphenyl)prop-2-en-1-one (PubChem CID 102317524) has the molecular formula C26H32NO3+ and a molecular weight of 406.55 g/mol. Its IUPAC name is (E)-1-[1-ethyl-4-hydroxy-1-methyl-4-[(E)-2-phenylethenyl]piperidin-1-ium-3-yl]-3-(4-methoxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-1-[1-ethyl-4-hydroxy-1-methyl-4-[(E)-2-phenylethenyl]piperidin-1-ium-3-yl]-3-(4-methoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 102317524 |
| Molecular Formula | C26H32NO3+ |
| Molecular Weight | 406.55 g/mol |
| Exact Mass | 406.24 |
| IUPAC Name | (E)-1-[1-ethyl-4-hydroxy-1-methyl-4-[(E)-2-phenylethenyl]piperidin-1-ium-3-yl]-3-(4-methoxyphenyl)prop-2-en-1-one |
| SMILES | CC[N+]1(C)CCC(O)(/C=C/c2ccccc2)C(C(=O)/C=C/c2ccc(OC)cc2)C1 |
| InChI | InChI=1S/C26H32NO3/c1-4-27(2)19-18-26(29,17-16-21-8-6-5-7-9-21)24(20-27)25(28)15-12-22-10-13-23(30-3)14-11-22/h5-17,24,29H,4,18-20H2,1-3H3/q+1/b15-12+,17-16+ |
| InChIKey | OTLFIZYLCRCMKQ-PYWSDYSGSA-N |
| XLogP | 4.21 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.55 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|