C23H30INO4 — CID 10529729
[1-ethyl-4-hydroxy-4-(4-methoxyphenyl)-1-methylpiperidin-1-ium-3-yl]-(4-methoxyphenyl)methanone iodide (PubChem CID 10529729) has the molecular formula C23H30INO4 and a molecular weight of 511.40 g/mol. Its IUPAC name is [1-ethyl-4-hydroxy-4-(4-methoxyphenyl)-1-methylpiperidin-1-ium-3-yl]-(4-methoxyphenyl)methanone iodide.
| Compound Name | [1-ethyl-4-hydroxy-4-(4-methoxyphenyl)-1-methylpiperidin-1-ium-3-yl]-(4-methoxyphenyl)methanone iodide |
|---|---|
| PubChem CID | 10529729 |
| Molecular Formula | C23H30INO4 |
| Molecular Weight | 511.40 g/mol |
| Exact Mass | 511.12 |
| IUPAC Name | [1-ethyl-4-hydroxy-4-(4-methoxyphenyl)-1-methylpiperidin-1-ium-3-yl]-(4-methoxyphenyl)methanone iodide |
| SMILES | CC[N+]1(C)CCC(O)(c2ccc(OC)cc2)C(C(=O)c2ccc(OC)cc2)C1.[I-] |
| InChI | InChI=1S/C23H30NO4.HI/c1-5-24(2)15-14-23(26,18-8-12-20(28-4)13-9-18)21(16-24)22(25)17-6-10-19(27-3)11-7-17;/h6-13,21,26H,5,14-16H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | DBGWBQNPOFCGSH-UHFFFAOYSA-M |
| XLogP | 0.26 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.40 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|