C25H30BrNO2 — CID 5386939
(E)-1-[1-ethyl-4-hydroxy-1-methyl-4-[(E)-2-phenylethenyl]piperidin-1-ium-3-yl]-3-phenylprop-2-en-1-one bromide (PubChem CID 5386939) has the molecular formula C25H30BrNO2 and a molecular weight of 456.42 g/mol. Its IUPAC name is (E)-1-[1-ethyl-4-hydroxy-1-methyl-4-[(E)-2-phenylethenyl]piperidin-1-ium-3-yl]-3-phenylprop-2-en-1-one bromide.
| Compound Name | (E)-1-[1-ethyl-4-hydroxy-1-methyl-4-[(E)-2-phenylethenyl]piperidin-1-ium-3-yl]-3-phenylprop-2-en-1-one bromide |
|---|---|
| PubChem CID | 5386939 |
| Molecular Formula | C25H30BrNO2 |
| Molecular Weight | 456.42 g/mol |
| Exact Mass | 455.15 |
| IUPAC Name | (E)-1-[1-ethyl-4-hydroxy-1-methyl-4-[(E)-2-phenylethenyl]piperidin-1-ium-3-yl]-3-phenylprop-2-en-1-one bromide |
| SMILES | CC[N+]1(C)CCC(O)(/C=C/c2ccccc2)C(C(=O)/C=C/c2ccccc2)C1.[Br-] |
| InChI | InChI=1S/C25H30NO2.BrH/c1-3-26(2)19-18-25(28,17-16-22-12-8-5-9-13-22)23(20-26)24(27)15-14-21-10-6-4-7-11-21;/h4-17,23,28H,3,18-20H2,1-2H3;1H/q+1;/p-1/b15-14+,17-16+; |
| InChIKey | USLKKRPHCVKRBA-OHAASFOQSA-M |
| XLogP | 1.20 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.42 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|