C25H26NOP — CID 24808217
N-diphenylphosphoryl-1-(3-phenylcyclohex-3-en-1-yl)methanamine (PubChem CID 24808217) has the molecular formula C25H26NOP and a molecular weight of 387.46 g/mol. Its IUPAC name is N-diphenylphosphoryl-1-(3-phenylcyclohex-3-en-1-yl)methanamine.
| Compound Name | N-diphenylphosphoryl-1-(3-phenylcyclohex-3-en-1-yl)methanamine |
|---|---|
| PubChem CID | 24808217 |
| Molecular Formula | C25H26NOP |
| Molecular Weight | 387.46 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | N-diphenylphosphoryl-1-(3-phenylcyclohex-3-en-1-yl)methanamine |
| SMILES | O=P(NCC1CCC=C(c2ccccc2)C1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H26NOP/c27-28(24-15-6-2-7-16-24,25-17-8-3-9-18-25)26-20-21-11-10-14-23(19-21)22-12-4-1-5-13-22/h1-9,12-18,21H,10-11,19-20H2,(H,26,27) |
| InChIKey | KBYNLJASEGDDEY-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.46 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|