C30H20NO4P — CID 139222180
3-(triphenyl-λ5-phosphanylidene)-1H-chromeno[4,3-b]pyridine-2,4,5-trione (PubChem CID 139222180) has the molecular formula C30H20NO4P and a molecular weight of 489.47 g/mol. Its IUPAC name is 3-(triphenyl-λ5-phosphanylidene)-1H-chromeno[4,3-b]pyridine-2,4,5-trione.
| Compound Name | 3-(triphenyl-λ5-phosphanylidene)-1H-chromeno[4,3-b]pyridine-2,4,5-trione |
|---|---|
| PubChem CID | 139222180 |
| Molecular Formula | C30H20NO4P |
| Molecular Weight | 489.47 g/mol |
| Exact Mass | 489.11 |
| IUPAC Name | 3-(triphenyl-λ5-phosphanylidene)-1H-chromeno[4,3-b]pyridine-2,4,5-trione |
| SMILES | O=C1Nc2c(c(=O)oc3ccccc23)C(=O)C1=P(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H20NO4P/c32-27-25-26(23-18-10-11-19-24(23)35-30(25)34)31-29(33)28(27)36(20-12-4-1-5-13-20,21-14-6-2-7-15-21)22-16-8-3-9-17-22/h1-19H,(H,31,33) |
| InChIKey | QTKWYUZVVKGFEA-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.47 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|