C19H9NO5 — CID 25232688
2,10-dioxa-13-azapentacyclo[12.8.0.03,12.04,9.016,21]docosa-1(14),3(12),4,6,8,16,18,20-octaene-11,15,22-trione (PubChem CID 25232688) has the molecular formula C19H9NO5 and a molecular weight of 331.28 g/mol. Its IUPAC name is 2,10-dioxa-13-azapentacyclo[12.8.0.03,12.04,9.016,21]docosa-1(14),3(12),4,6,8,16,18,20-octaene-11,15,22-trione.
| Compound Name | 2,10-dioxa-13-azapentacyclo[12.8.0.03,12.04,9.016,21]docosa-1(14),3(12),4,6,8,16,18,20-octaene-11,15,22-trione |
|---|---|
| PubChem CID | 25232688 |
| Molecular Formula | C19H9NO5 |
| Molecular Weight | 331.28 g/mol |
| Exact Mass | 331.05 |
| IUPAC Name | 2,10-dioxa-13-azapentacyclo[12.8.0.03,12.04,9.016,21]docosa-1(14),3(12),4,6,8,16,18,20-octaene-11,15,22-trione |
| SMILES | O=c1c2[nH]c3c(=O)oc4ccccc4c3oc=2c(=O)c2ccccc12 |
| InChI | InChI=1S/C19H9NO5/c21-15-9-5-1-2-6-10(9)16(22)18-13(15)20-14-17(25-18)11-7-3-4-8-12(11)24-19(14)23/h1-8,20H |
| InChIKey | HMUPQVGXJCPRFC-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 93.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.28 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|