C31H21Br2P — CID 12591469
(2,7-dibromofluoren-9-ylidene)-triphenyl-λ5-phosphane (PubChem CID 12591469) has the molecular formula C31H21Br2P and a molecular weight of 584.29 g/mol. Its IUPAC name is (2,7-dibromofluoren-9-ylidene)-triphenyl-λ5-phosphane.
| Compound Name | (2,7-dibromofluoren-9-ylidene)-triphenyl-λ5-phosphane |
|---|---|
| PubChem CID | 12591469 |
| Molecular Formula | C31H21Br2P |
| Molecular Weight | 584.29 g/mol |
| Exact Mass | 581.97 |
| IUPAC Name | (2,7-dibromofluoren-9-ylidene)-triphenyl-λ5-phosphane |
| SMILES | Brc1ccc2c(c1)C(=P(c1ccccc1)(c1ccccc1)c1ccccc1)c1cc(Br)ccc1-2 |
| InChI | InChI=1S/C31H21Br2P/c32-22-16-18-27-28-19-17-23(33)21-30(28)31(29(27)20-22)34(24-10-4-1-5-11-24,25-12-6-2-7-13-25)26-14-8-3-9-15-26/h1-21H |
| InChIKey | QPQIZPPTDLHQCP-UHFFFAOYSA-N |
| XLogP | 7.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.29 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|