C19H13NO2S — CID 10495868
3'-methylimino-5'-phenylspiro[indene-2,2'-thiophene]-1,3-dione (PubChem CID 10495868) has the molecular formula C19H13NO2S and a molecular weight of 319.39 g/mol. Its IUPAC name is 3'-methylimino-5'-phenylspiro[indene-2,2'-thiophene]-1,3-dione.
| Compound Name | 3'-methylimino-5'-phenylspiro[indene-2,2'-thiophene]-1,3-dione |
|---|---|
| PubChem CID | 10495868 |
| Molecular Formula | C19H13NO2S |
| Molecular Weight | 319.39 g/mol |
| Exact Mass | 319.07 |
| IUPAC Name | 3'-methylimino-5'-phenylspiro[indene-2,2'-thiophene]-1,3-dione |
| SMILES | C/N=C1\C=C(c2ccccc2)SC12C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C19H13NO2S/c1-20-16-11-15(12-7-3-2-4-8-12)23-19(16)17(21)13-9-5-6-10-14(13)18(19)22/h2-11H,1H3/b20-16+ |
| InChIKey | UHTVDDWGQJWDCD-CAPFRKAQSA-N |
| XLogP | 3.66 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.39 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|