C9H4O3S — CID 102009407
spiro[indene-2,3'-oxathiirane]-1,3-dione (PubChem CID 102009407) has the molecular formula C9H4O3S and a molecular weight of 192.19 g/mol. Its IUPAC name is spiro[indene-2,3'-oxathiirane]-1,3-dione.
| Compound Name | spiro[indene-2,3'-oxathiirane]-1,3-dione |
|---|---|
| PubChem CID | 102009407 |
| Molecular Formula | C9H4O3S |
| Molecular Weight | 192.19 g/mol |
| Exact Mass | 191.99 |
| IUPAC Name | spiro[indene-2,3'-oxathiirane]-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)C12OS2 |
| InChI | InChI=1S/C9H4O3S/c10-7-5-3-1-2-4-6(5)8(11)9(7)12-13-9/h1-4H |
| InChIKey | CAIRGXWPSZVNPH-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 46.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.19 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|