C10H8N2O3 — CID 163884813
1a,7a-diaminonaphtho[2,3-b]oxirene-2,7-dione (PubChem CID 163884813) has the molecular formula C10H8N2O3 and a molecular weight of 204.19 g/mol. Its IUPAC name is 1a,7a-diaminonaphtho[2,3-b]oxirene-2,7-dione.
| Compound Name | 1a,7a-diaminonaphtho[2,3-b]oxirene-2,7-dione |
|---|---|
| PubChem CID | 163884813 |
| Molecular Formula | C10H8N2O3 |
| Molecular Weight | 204.19 g/mol |
| Exact Mass | 204.05 |
| IUPAC Name | 1a,7a-diaminonaphtho[2,3-b]oxirene-2,7-dione |
| SMILES | NC12OC1(N)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C10H8N2O3/c11-9-7(13)5-3-1-2-4-6(5)8(14)10(9,12)15-9/h1-4H,11-12H2 |
| InChIKey | PWKUPBFMCYQIAF-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 98.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.19 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|