C20H14N2O2S2 — CID 10894172
8,10-diphenyl-3-sulfanylidene-9-thia-2,4-diazaspiro[5.5]undeca-7,10-diene-1,5-dione (PubChem CID 10894172) has the molecular formula C20H14N2O2S2 and a molecular weight of 378.48 g/mol. Its IUPAC name is 8,10-diphenyl-3-sulfanylidene-9-thia-2,4-diazaspiro[5.5]undeca-7,10-diene-1,5-dione.
| Compound Name | 8,10-diphenyl-3-sulfanylidene-9-thia-2,4-diazaspiro[5.5]undeca-7,10-diene-1,5-dione |
|---|---|
| PubChem CID | 10894172 |
| Molecular Formula | C20H14N2O2S2 |
| Molecular Weight | 378.48 g/mol |
| Exact Mass | 378.05 |
| IUPAC Name | 8,10-diphenyl-3-sulfanylidene-9-thia-2,4-diazaspiro[5.5]undeca-7,10-diene-1,5-dione |
| SMILES | O=C1NC(=S)NC(=O)C12C=C(c1ccccc1)SC(c1ccccc1)=C2 |
| InChI | InChI=1S/C20H14N2O2S2/c23-17-20(18(24)22-19(25)21-17)11-15(13-7-3-1-4-8-13)26-16(12-20)14-9-5-2-6-10-14/h1-12H,(H2,21,22,23,24,25) |
| InChIKey | HNXBCPOHHKUBPT-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.48 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|