C11H6S5 — CID 11358458
5-phenyl-[1,3]dithiolo[4,5-b][1,4]dithiine-2-thione (PubChem CID 11358458) has the molecular formula C11H6S5 and a molecular weight of 298.50 g/mol. Its IUPAC name is 5-phenyl-[1,3]dithiolo[4,5-b][1,4]dithiine-2-thione.
| Compound Name | 5-phenyl-[1,3]dithiolo[4,5-b][1,4]dithiine-2-thione |
|---|---|
| PubChem CID | 11358458 |
| Molecular Formula | C11H6S5 |
| Molecular Weight | 298.50 g/mol |
| Exact Mass | 297.91 |
| IUPAC Name | 5-phenyl-[1,3]dithiolo[4,5-b][1,4]dithiine-2-thione |
| SMILES | S=c1sc2c(s1)SC(c1ccccc1)=CS2 |
| InChI | InChI=1S/C11H6S5/c12-11-15-9-10(16-11)14-8(6-13-9)7-4-2-1-3-5-7/h1-6H |
| InChIKey | KLNWZLPNMUHEKE-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.50 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|