C37H38S — CID 10436533
2,6-bis(4-tert-butylphenyl)-4,4-diphenylthiopyran (PubChem CID 10436533) has the molecular formula C37H38S and a molecular weight of 514.78 g/mol. Its IUPAC name is 2,6-bis(4-tert-butylphenyl)-4,4-diphenylthiopyran.
| Compound Name | 2,6-bis(4-tert-butylphenyl)-4,4-diphenylthiopyran |
|---|---|
| PubChem CID | 10436533 |
| Molecular Formula | C37H38S |
| Molecular Weight | 514.78 g/mol |
| Exact Mass | 514.27 |
| IUPAC Name | 2,6-bis(4-tert-butylphenyl)-4,4-diphenylthiopyran |
| SMILES | CC(C)(C)c1ccc(C2=CC(c3ccccc3)(c3ccccc3)C=C(c3ccc(C(C)(C)C)cc3)S2)cc1 |
| InChI | InChI=1S/C37H38S/c1-35(2,3)29-21-17-27(18-22-29)33-25-37(31-13-9-7-10-14-31,32-15-11-8-12-16-32)26-34(38-33)28-19-23-30(24-20-28)36(4,5)6/h7-26H,1-6H3 |
| InChIKey | FSCOWGPPIHLREP-UHFFFAOYSA-N |
| XLogP | 10.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.78 |
| LogP ≤ 5 | 10.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |