C19H21N3O3 — CID 123239038
tert-butyl 3-[4-(2-cyano-2-isocyanoethenyl)phenoxy]pyrrolidine-1-carboxylate (PubChem CID 123239038) has the molecular formula C19H21N3O3 and a molecular weight of 339.40 g/mol. Its IUPAC name is tert-butyl 3-[4-(2-cyano-2-isocyanoethenyl)phenoxy]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-[4-(2-cyano-2-isocyanoethenyl)phenoxy]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 123239038 |
| Molecular Formula | C19H21N3O3 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | tert-butyl 3-[4-(2-cyano-2-isocyanoethenyl)phenoxy]pyrrolidine-1-carboxylate |
| SMILES | [C-]#[N+]C(C#N)=Cc1ccc(OC2CCN(C(=O)OC(C)(C)C)C2)cc1 |
| InChI | InChI=1S/C19H21N3O3/c1-19(2,3)25-18(23)22-10-9-17(13-22)24-16-7-5-14(6-8-16)11-15(12-20)21-4/h5-8,11,17H,9-10,13H2,1-3H3 |
| InChIKey | YUAPIBXREYDWKK-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|