C24H27Cl2N3O3 — CID 123239908
1-[4-[4-chloro-5-(2-chlorophenyl)-2-methoxybenzoyl]piperazin-1-yl]-4-(dimethylamino)but-2-en-1-one (PubChem CID 123239908) has the molecular formula C24H27Cl2N3O3 and a molecular weight of 476.40 g/mol. Its IUPAC name is 1-[4-[4-chloro-5-(2-chlorophenyl)-2-methoxybenzoyl]piperazin-1-yl]-4-(dimethylamino)but-2-en-1-one.
| Compound Name | 1-[4-[4-chloro-5-(2-chlorophenyl)-2-methoxybenzoyl]piperazin-1-yl]-4-(dimethylamino)but-2-en-1-one |
|---|---|
| PubChem CID | 123239908 |
| Molecular Formula | C24H27Cl2N3O3 |
| Molecular Weight | 476.40 g/mol |
| Exact Mass | 475.14 |
| IUPAC Name | 1-[4-[4-chloro-5-(2-chlorophenyl)-2-methoxybenzoyl]piperazin-1-yl]-4-(dimethylamino)but-2-en-1-one |
| SMILES | COc1cc(Cl)c(-c2ccccc2Cl)cc1C(=O)N1CCN(C(=O)C=CCN(C)C)CC1 |
| InChI | InChI=1S/C24H27Cl2N3O3/c1-27(2)10-6-9-23(30)28-11-13-29(14-12-28)24(31)19-15-18(21(26)16-22(19)32-3)17-7-4-5-8-20(17)25/h4-9,15-16H,10-14H2,1-3H3 |
| InChIKey | CDEQHWHCBSDKJR-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.40 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|