C22H25ClN2O3 — CID 144720319
(5-chloro-2-methoxy-4-phenylphenyl)-(4-methylpiperazin-1-yl)methanone;prop-2-enal (PubChem CID 144720319) has the molecular formula C22H25ClN2O3 and a molecular weight of 400.91 g/mol. Its IUPAC name is (5-chloro-2-methoxy-4-phenylphenyl)-(4-methylpiperazin-1-yl)methanone;prop-2-enal.
| Compound Name | (5-chloro-2-methoxy-4-phenylphenyl)-(4-methylpiperazin-1-yl)methanone;prop-2-enal |
|---|---|
| PubChem CID | 144720319 |
| Molecular Formula | C22H25ClN2O3 |
| Molecular Weight | 400.91 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | (5-chloro-2-methoxy-4-phenylphenyl)-(4-methylpiperazin-1-yl)methanone;prop-2-enal |
| SMILES | C=CC=O.COc1cc(-c2ccccc2)c(Cl)cc1C(=O)N1CCN(C)CC1 |
| InChI | InChI=1S/C19H21ClN2O2.C3H4O/c1-21-8-10-22(11-9-21)19(23)16-12-17(20)15(13-18(16)24-2)14-6-4-3-5-7-14;1-2-3-4/h3-7,12-13H,8-11H2,1-2H3;2-3H,1H2 |
| InChIKey | VGHZUIGUOXTUBA-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.91 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|