C17H15F2N5OS — CID 123240154
(2R)-2-(2,4-difluorophenyl)-1-[(3-isocyano-5-methylthiophen-2-yl)amino]-3-(1,2,4-triazol-1-yl)propan-2-ol (PubChem CID 123240154) has the molecular formula C17H15F2N5OS and a molecular weight of 375.40 g/mol. Its IUPAC name is (2R)-2-(2,4-difluorophenyl)-1-[(3-isocyano-5-methylthiophen-2-yl)amino]-3-(1,2,4-triazol-1-yl)propan-2-ol.
| Compound Name | (2R)-2-(2,4-difluorophenyl)-1-[(3-isocyano-5-methylthiophen-2-yl)amino]-3-(1,2,4-triazol-1-yl)propan-2-ol |
|---|---|
| PubChem CID | 123240154 |
| Molecular Formula | C17H15F2N5OS |
| Molecular Weight | 375.40 g/mol |
| Exact Mass | 375.10 |
| IUPAC Name | (2R)-2-(2,4-difluorophenyl)-1-[(3-isocyano-5-methylthiophen-2-yl)amino]-3-(1,2,4-triazol-1-yl)propan-2-ol |
| SMILES | [C-]#[N+]c1cc(C)sc1NC[C@@](O)(Cn1cncn1)c1ccc(F)cc1F |
| InChI | InChI=1S/C17H15F2N5OS/c1-11-5-15(20-2)16(26-11)22-7-17(25,8-24-10-21-9-23-24)13-4-3-12(18)6-14(13)19/h3-6,9-10,22,25H,7-8H2,1H3/t17-/m1/s1 |
| InChIKey | NGPBWKDGKHZNMY-QGZVFWFLSA-N |
| XLogP | 3.48 |
| TPSA | 67.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.40 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|