C12H24N2 — CID 123240449
2-cyclohexylimino-N,N-dimethylbutan-1-amine (PubChem CID 123240449) has the molecular formula C12H24N2 and a molecular weight of 196.34 g/mol. Its IUPAC name is 2-cyclohexylimino-N,N-dimethylbutan-1-amine.
| Compound Name | 2-cyclohexylimino-N,N-dimethylbutan-1-amine |
|---|---|
| PubChem CID | 123240449 |
| Molecular Formula | C12H24N2 |
| Molecular Weight | 196.34 g/mol |
| Exact Mass | 196.19 |
| IUPAC Name | 2-cyclohexylimino-N,N-dimethylbutan-1-amine |
| SMILES | CC/C(CN(C)C)=N\C1CCCCC1 |
| InChI | InChI=1S/C12H24N2/c1-4-11(10-14(2)3)13-12-8-6-5-7-9-12/h12H,4-10H2,1-3H3/b13-11+ |
| InChIKey | OXIUQKLTGQHHNC-ACCUITESSA-N |
| XLogP | 2.73 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.34 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|