About 3-amino-N-ethyl-1,5-dimethylpyrazole-4-carboxamide
3-amino-N-ethyl-1,5-dimethylpyrazole-4-carboxamide (PubChem CID 123241480) has the molecular formula C8H14N4O
and a molecular weight of 182.23 g/mol. Its IUPAC name is 3-amino-N-ethyl-1,5-dimethylpyrazole-4-carboxamide.
Molecular Properties
| Compound Name | 3-amino-N-ethyl-1,5-dimethylpyrazole-4-carboxamide |
| PubChem CID | 123241480 |
| Molecular Formula | C8H14N4O |
| Molecular Weight | 182.23 g/mol |
| Exact Mass | 182.12 |
| IUPAC Name | 3-amino-N-ethyl-1,5-dimethylpyrazole-4-carboxamide |
| SMILES | CCNC(=O)c1c(N)nn(C)c1C |
| InChI | InChI=1S/C8H14N4O/c1-4-10-8(13)6-5(2)12(3)11-7(6)9/h4H2,1-3H3,(H2,9,11)(H,10,13) |
| InChIKey | PJIZSPWFGWWGQD-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.23 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-amino-N-ethyl-1,5-dimethylpyrazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-N-ethyl-1,5-dimethylpyrazole-4-carboxamide?
The IUPAC name of 3-amino-N-ethyl-1,5-dimethylpyrazole-4-carboxamide (CID 123241480) is 3-amino-N-ethyl-1,5-dimethylpyrazole-4-carboxamide.
What is the SMILES notation for 3-amino-N-ethyl-1,5-dimethylpyrazole-4-carboxamide?
The canonical SMILES for 3-amino-N-ethyl-1,5-dimethylpyrazole-4-carboxamide is CCNC(=O)c1c(N)nn(C)c1C.
What is the InChIKey of 3-amino-N-ethyl-1,5-dimethylpyrazole-4-carboxamide?
The InChIKey is PJIZSPWFGWWGQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N4O/c1-4-10-8(13)6-5(2)12(3)11-7(6)9/h4H2,1-3H3,(H2,9,11)(H,10,13).
What are the key properties of 3-amino-N-ethyl-1,5-dimethylpyrazole-4-carboxamide?
3-amino-N-ethyl-1,5-dimethylpyrazole-4-carboxamide has a molecular weight of 182.23 g/mol, XLogP of 0.06, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-N-ethyl-1,5-dimethylpyrazole-4-carboxamide is sourced from PubChem (CID 123241480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).