C8H14N4O — CID 123241480
3-amino-N-ethyl-1,5-dimethylpyrazole-4-carboxamide (PubChem CID 123241480) has the molecular formula C8H14N4O and a molecular weight of 182.23 g/mol. Its IUPAC name is 3-amino-N-ethyl-1,5-dimethylpyrazole-4-carboxamide.
| Compound Name | 3-amino-N-ethyl-1,5-dimethylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 123241480 |
| Molecular Formula | C8H14N4O |
| Molecular Weight | 182.23 g/mol |
| Exact Mass | 182.12 |
| IUPAC Name | 3-amino-N-ethyl-1,5-dimethylpyrazole-4-carboxamide |
| SMILES | CCNC(=O)c1c(N)nn(C)c1C |
| InChI | InChI=1S/C8H14N4O/c1-4-10-8(13)6-5(2)12(3)11-7(6)9/h4H2,1-3H3,(H2,9,11)(H,10,13) |
| InChIKey | PJIZSPWFGWWGQD-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.23 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |