C12H15ClN2O3 — CID 123243037
azane;2-chloro-3-[4-(2-oxoethyliminomethyl)phenyl]propanoic acid (PubChem CID 123243037) has the molecular formula C12H15ClN2O3 and a molecular weight of 270.72 g/mol. Its IUPAC name is azane;2-chloro-3-[4-(2-oxoethyliminomethyl)phenyl]propanoic acid.
| Compound Name | azane;2-chloro-3-[4-(2-oxoethyliminomethyl)phenyl]propanoic acid |
|---|---|
| PubChem CID | 123243037 |
| Molecular Formula | C12H15ClN2O3 |
| Molecular Weight | 270.72 g/mol |
| Exact Mass | 270.08 |
| IUPAC Name | azane;2-chloro-3-[4-(2-oxoethyliminomethyl)phenyl]propanoic acid |
| SMILES | N.O=CC/N=C/c1ccc(CC(Cl)C(=O)O)cc1 |
| InChI | InChI=1S/C12H12ClNO3.H3N/c13-11(12(16)17)7-9-1-3-10(4-2-9)8-14-5-6-15;/h1-4,6,8,11H,5,7H2,(H,16,17);1H3/b14-8+; |
| InChIKey | YPZMCMAMMXTYLG-XHIXCECLSA-N |
| XLogP | 1.70 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.72 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|