C28H33F2N3O3+2 — CID 123243988
3-(5,6-diethyl-1,3-difluoro-10-methoxy-5-methylpyrido[2,1-a][2,7]naphthyridin-7-ium-6-yl)propyl 1-methylpyridin-1-ium-2-carboxylate (PubChem CID 123243988) has the molecular formula C28H33F2N3O3+2 and a molecular weight of 497.59 g/mol. Its IUPAC name is 3-(5,6-diethyl-1,3-difluoro-10-methoxy-5-methylpyrido[2,1-a][2,7]naphthyridin-7-ium-6-yl)propyl 1-methylpyridin-1-ium-2-carboxylate.
| Compound Name | 3-(5,6-diethyl-1,3-difluoro-10-methoxy-5-methylpyrido[2,1-a][2,7]naphthyridin-7-ium-6-yl)propyl 1-methylpyridin-1-ium-2-carboxylate |
|---|---|
| PubChem CID | 123243988 |
| Molecular Formula | C28H33F2N3O3+2 |
| Molecular Weight | 497.59 g/mol |
| Exact Mass | 497.25 |
| IUPAC Name | 3-(5,6-diethyl-1,3-difluoro-10-methoxy-5-methylpyrido[2,1-a][2,7]naphthyridin-7-ium-6-yl)propyl 1-methylpyridin-1-ium-2-carboxylate |
| SMILES | CCC1(C)c2cc(F)nc(F)c2-c2cc(OC)cc[n+]2C1(CC)CCCOC(=O)c1cccc[n+]1C |
| InChI | InChI=1S/C28H33F2N3O3/c1-6-27(3)20-18-23(29)31-25(30)24(20)22-17-19(35-5)12-15-33(22)28(27,7-2)13-10-16-36-26(34)21-11-8-9-14-32(21)4/h8-9,11-12,14-15,17-18H,6-7,10,13,16H2,1-5H3/q+2 |
| InChIKey | BGXXKYNXHGXLSV-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 56.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.59 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|