C33H42FN3O2+2 — CID 90912905
4-[6,7,7-triethyl-1-(2-ethylbutyl)-9-fluoro-3-methylpyrazino[2,1-a]isoquinolin-5-ium-6-yl]-3,4-dihydropyrido[2,1-c][1,4]oxazin-5-ium-1-one (PubChem CID 90912905) has the molecular formula C33H42FN3O2+2 and a molecular weight of 531.72 g/mol. Its IUPAC name is 4-[6,7,7-triethyl-1-(2-ethylbutyl)-9-fluoro-3-methylpyrazino[2,1-a]isoquinolin-5-ium-6-yl]-3,4-dihydropyrido[2,1-c][1,4]oxazin-5-ium-1-one.
| Compound Name | 4-[6,7,7-triethyl-1-(2-ethylbutyl)-9-fluoro-3-methylpyrazino[2,1-a]isoquinolin-5-ium-6-yl]-3,4-dihydropyrido[2,1-c][1,4]oxazin-5-ium-1-one |
|---|---|
| PubChem CID | 90912905 |
| Molecular Formula | C33H42FN3O2+2 |
| Molecular Weight | 531.72 g/mol |
| Exact Mass | 531.33 |
| IUPAC Name | 4-[6,7,7-triethyl-1-(2-ethylbutyl)-9-fluoro-3-methylpyrazino[2,1-a]isoquinolin-5-ium-6-yl]-3,4-dihydropyrido[2,1-c][1,4]oxazin-5-ium-1-one |
| SMILES | CCC(CC)Cc1nc(C)c[n+]2c1-c1ccc(F)cc1C(CC)(CC)C2(CC)C1COC(=O)c2cccc[n+]21 |
| InChI | InChI=1S/C33H42FN3O2/c1-7-23(8-2)18-27-30-25-16-15-24(34)19-26(25)32(9-3,10-4)33(11-5,37(30)20-22(6)35-27)29-21-39-31(38)28-14-12-13-17-36(28)29/h12-17,19-20,23,29H,7-11,18,21H2,1-6H3/q+2 |
| InChIKey | KYCZOHVNXCJLQX-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 46.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.72 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|