C37H31F3N2O2+2 — CID 91496095
4-[3,5-difluoro-2-[1-[(3-fluoro-5-methyl-8-tricyclo[8.4.2.02,7]hexadeca-1(15),2(7),3,5,11,13-hexaenyl)methyl]pyridin-1-ium-2-yl]phenyl]-3,4-dihydropyrido[2,1-c][1,4]oxazin-5-ium-1-one (PubChem CID 91496095) has the molecular formula C37H31F3N2O2+2 and a molecular weight of 592.66 g/mol. Its IUPAC name is 4-[3,5-difluoro-2-[1-[(3-fluoro-5-methyl-8-tricyclo[8.4.2.02,7]hexadeca-1(15),2(7),3,5,11,13-hexaenyl)methyl]pyridin-1-ium-2-yl]phenyl]-3,4-dihydropyrido[2,1-c][1,4]oxazin-5-ium-1-one.
| Compound Name | 4-[3,5-difluoro-2-[1-[(3-fluoro-5-methyl-8-tricyclo[8.4.2.02,7]hexadeca-1(15),2(7),3,5,11,13-hexaenyl)methyl]pyridin-1-ium-2-yl]phenyl]-3,4-dihydropyrido[2,1-c][1,4]oxazin-5-ium-1-one |
|---|---|
| PubChem CID | 91496095 |
| Molecular Formula | C37H31F3N2O2+2 |
| Molecular Weight | 592.66 g/mol |
| Exact Mass | 592.23 |
| IUPAC Name | 4-[3,5-difluoro-2-[1-[(3-fluoro-5-methyl-8-tricyclo[8.4.2.02,7]hexadeca-1(15),2(7),3,5,11,13-hexaenyl)methyl]pyridin-1-ium-2-yl]phenyl]-3,4-dihydropyrido[2,1-c][1,4]oxazin-5-ium-1-one |
| SMILES | Cc1cc(F)c2c(c1)C(C[n+]1ccccc1-c1c(F)cc(F)cc1C1COC(=O)c3cccc[n+]31)CC1C=CC=CC2=CC1 |
| InChI | InChI=1S/C37H31F3N2O2/c1-23-16-28-26(18-24-8-2-3-9-25(13-12-24)35(28)30(39)17-23)21-41-14-6-4-10-32(41)36-29(19-27(38)20-31(36)40)34-22-44-37(43)33-11-5-7-15-42(33)34/h2-11,13-17,19-20,24,26,34H,12,18,21-22H2,1H3/q+2 |
| InChIKey | BKRJHTFBPVCNMC-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.66 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|