C17H12N4O2 — CID 123246029
(4-methylphenyl) [1,2,4]triazolo[4,3-a]quinoxaline-8-carboxylate (PubChem CID 123246029) has the molecular formula C17H12N4O2 and a molecular weight of 304.31 g/mol. Its IUPAC name is (4-methylphenyl) [1,2,4]triazolo[4,3-a]quinoxaline-8-carboxylate.
| Compound Name | (4-methylphenyl) [1,2,4]triazolo[4,3-a]quinoxaline-8-carboxylate |
|---|---|
| PubChem CID | 123246029 |
| Molecular Formula | C17H12N4O2 |
| Molecular Weight | 304.31 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | (4-methylphenyl) [1,2,4]triazolo[4,3-a]quinoxaline-8-carboxylate |
| SMILES | Cc1ccc(OC(=O)c2ccc3ncc4nncn4c3c2)cc1 |
| InChI | InChI=1S/C17H12N4O2/c1-11-2-5-13(6-3-11)23-17(22)12-4-7-14-15(8-12)21-10-19-20-16(21)9-18-14/h2-10H,1H3 |
| InChIKey | DCDSAHALJSIIKV-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 69.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.31 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|