C28H62O2Si3 — CID 123246322
2-[dimethyl(propan-2-yl)silyl]oxypropan-2-yl-[2-[dimethyl(3,5,5,7-tetramethyloct-7-en-3-yl)silyl]butan-2-yloxy]-dimethylsilane (PubChem CID 123246322) has the molecular formula C28H62O2Si3 and a molecular weight of 515.06 g/mol. Its IUPAC name is 2-[dimethyl(propan-2-yl)silyl]oxypropan-2-yl-[2-[dimethyl(3,5,5,7-tetramethyloct-7-en-3-yl)silyl]butan-2-yloxy]-dimethylsilane.
| Compound Name | 2-[dimethyl(propan-2-yl)silyl]oxypropan-2-yl-[2-[dimethyl(3,5,5,7-tetramethyloct-7-en-3-yl)silyl]butan-2-yloxy]-dimethylsilane |
|---|---|
| PubChem CID | 123246322 |
| Molecular Formula | C28H62O2Si3 |
| Molecular Weight | 515.06 g/mol |
| Exact Mass | 514.41 |
| IUPAC Name | 2-[dimethyl(propan-2-yl)silyl]oxypropan-2-yl-[2-[dimethyl(3,5,5,7-tetramethyloct-7-en-3-yl)silyl]butan-2-yloxy]-dimethylsilane |
| SMILES | C=C(C)CC(C)(C)CC(C)(CC)[Si](C)(C)C(C)(CC)O[Si](C)(C)C(C)(C)O[Si](C)(C)C(C)C |
| InChI | InChI=1S/C28H62O2Si3/c1-19-27(11,22-25(7,8)21-23(3)4)32(15,16)28(12,20-2)30-33(17,18)26(9,10)29-31(13,14)24(5)6/h24H,3,19-22H2,1-2,4-18H3 |
| InChIKey | VVOZDTCNOHLPAV-UHFFFAOYSA-N |
| XLogP | 10.13 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.06 |
| LogP ≤ 5 | 10.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|