C17H38OSi2 — CID 123817780
dimethyl-(2,2,6,6-tetramethyl-3-methylideneheptan-4-yl)-trimethylsilyloxysilane (PubChem CID 123817780) has the molecular formula C17H38OSi2 and a molecular weight of 314.66 g/mol. Its IUPAC name is dimethyl-(2,2,6,6-tetramethyl-3-methylideneheptan-4-yl)-trimethylsilyloxysilane.
| Compound Name | dimethyl-(2,2,6,6-tetramethyl-3-methylideneheptan-4-yl)-trimethylsilyloxysilane |
|---|---|
| PubChem CID | 123817780 |
| Molecular Formula | C17H38OSi2 |
| Molecular Weight | 314.66 g/mol |
| Exact Mass | 314.25 |
| IUPAC Name | dimethyl-(2,2,6,6-tetramethyl-3-methylideneheptan-4-yl)-trimethylsilyloxysilane |
| SMILES | C=C(C(CC(C)(C)C)[Si](C)(C)O[Si](C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C17H38OSi2/c1-14(17(5,6)7)15(13-16(2,3)4)20(11,12)18-19(8,9)10/h15H,1,13H2,2-12H3 |
| InChIKey | OYYATQMSYVODRX-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.66 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|