C18H40OSi2 — CID 91458960
dimethyl-(2,2,7,7-tetramethyl-6-methylideneoctan-4-yl)-trimethylsilyloxysilane (PubChem CID 91458960) has the molecular formula C18H40OSi2 and a molecular weight of 328.69 g/mol. Its IUPAC name is dimethyl-(2,2,7,7-tetramethyl-6-methylideneoctan-4-yl)-trimethylsilyloxysilane.
| Compound Name | dimethyl-(2,2,7,7-tetramethyl-6-methylideneoctan-4-yl)-trimethylsilyloxysilane |
|---|---|
| PubChem CID | 91458960 |
| Molecular Formula | C18H40OSi2 |
| Molecular Weight | 328.69 g/mol |
| Exact Mass | 328.26 |
| IUPAC Name | dimethyl-(2,2,7,7-tetramethyl-6-methylideneoctan-4-yl)-trimethylsilyloxysilane |
| SMILES | C=C(CC(CC(C)(C)C)[Si](C)(C)O[Si](C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C18H40OSi2/c1-15(18(5,6)7)13-16(14-17(2,3)4)21(11,12)19-20(8,9)10/h16H,1,13-14H2,2-12H3 |
| InChIKey | ITXJGSQGQFLTNM-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.69 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|