C16H30Si — CID 10385985
3-(2,2-dimethylpropyl)octa-1,2,7-trienyl-trimethylsilane (PubChem CID 10385985) has the molecular formula C16H30Si and a molecular weight of 250.50 g/mol. Its IUPAC name is 3-(2,2-dimethylpropyl)octa-1,2,7-trienyl-trimethylsilane.
| Compound Name | 3-(2,2-dimethylpropyl)octa-1,2,7-trienyl-trimethylsilane |
|---|---|
| PubChem CID | 10385985 |
| Molecular Formula | C16H30Si |
| Molecular Weight | 250.50 g/mol |
| Exact Mass | 250.21 |
| IUPAC Name | 3-(2,2-dimethylpropyl)octa-1,2,7-trienyl-trimethylsilane |
| SMILES | C=CCCCC(=C=C[Si](C)(C)C)CC(C)(C)C |
| InChI | InChI=1S/C16H30Si/c1-8-9-10-11-15(14-16(2,3)4)12-13-17(5,6)7/h8,13H,1,9-11,14H2,2-7H3 |
| InChIKey | GALBPCZIXZNADG-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.50 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|