C18H38Si — CID 123718187
tert-butyl-[2-(2,2-dimethylpropyl)-3,3-dimethylpent-1-enyl]-dimethylsilane (PubChem CID 123718187) has the molecular formula C18H38Si and a molecular weight of 282.59 g/mol. Its IUPAC name is tert-butyl-[2-(2,2-dimethylpropyl)-3,3-dimethylpent-1-enyl]-dimethylsilane.
| Compound Name | tert-butyl-[2-(2,2-dimethylpropyl)-3,3-dimethylpent-1-enyl]-dimethylsilane |
|---|---|
| PubChem CID | 123718187 |
| Molecular Formula | C18H38Si |
| Molecular Weight | 282.59 g/mol |
| Exact Mass | 282.27 |
| IUPAC Name | tert-butyl-[2-(2,2-dimethylpropyl)-3,3-dimethylpent-1-enyl]-dimethylsilane |
| SMILES | CCC(C)(C)C(=C[Si](C)(C)C(C)(C)C)CC(C)(C)C |
| InChI | InChI=1S/C18H38Si/c1-12-18(8,9)15(13-16(2,3)4)14-19(10,11)17(5,6)7/h14H,12-13H2,1-11H3 |
| InChIKey | ZQJYRAJJNYEDPI-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.59 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|