C18H38Si — CID 91087956
[3-(3,3-dimethylbut-1-en-2-yl)-6,6-dimethylheptyl]-trimethylsilane (PubChem CID 91087956) has the molecular formula C18H38Si and a molecular weight of 282.59 g/mol. Its IUPAC name is [3-(3,3-dimethylbut-1-en-2-yl)-6,6-dimethylheptyl]-trimethylsilane.
| Compound Name | [3-(3,3-dimethylbut-1-en-2-yl)-6,6-dimethylheptyl]-trimethylsilane |
|---|---|
| PubChem CID | 91087956 |
| Molecular Formula | C18H38Si |
| Molecular Weight | 282.59 g/mol |
| Exact Mass | 282.27 |
| IUPAC Name | [3-(3,3-dimethylbut-1-en-2-yl)-6,6-dimethylheptyl]-trimethylsilane |
| SMILES | C=C(C(CCC(C)(C)C)CC[Si](C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C18H38Si/c1-15(18(5,6)7)16(11-13-17(2,3)4)12-14-19(8,9)10/h16H,1,11-14H2,2-10H3 |
| InChIKey | QQFVPUNXTJLQRG-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.59 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|