C17H36Si — CID 123337080
tert-butyl-(2-tert-butyl-4,4-dimethylpent-1-enyl)-dimethylsilane (PubChem CID 123337080) has the molecular formula C17H36Si and a molecular weight of 268.56 g/mol. Its IUPAC name is tert-butyl-(2-tert-butyl-4,4-dimethylpent-1-enyl)-dimethylsilane.
| Compound Name | tert-butyl-(2-tert-butyl-4,4-dimethylpent-1-enyl)-dimethylsilane |
|---|---|
| PubChem CID | 123337080 |
| Molecular Formula | C17H36Si |
| Molecular Weight | 268.56 g/mol |
| Exact Mass | 268.26 |
| IUPAC Name | tert-butyl-(2-tert-butyl-4,4-dimethylpent-1-enyl)-dimethylsilane |
| SMILES | CC(C)(C)CC(=C[Si](C)(C)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C17H36Si/c1-15(2,3)12-14(16(4,5)6)13-18(10,11)17(7,8)9/h13H,12H2,1-11H3 |
| InChIKey | DMIGHNSGTTWUJC-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.56 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|