C17H34Si — CID 164685025
triethyl(5,7,7-trimethylocta-3,4-dien-3-yl)silane (PubChem CID 164685025) has the molecular formula C17H34Si and a molecular weight of 266.54 g/mol. Its IUPAC name is triethyl(5,7,7-trimethylocta-3,4-dien-3-yl)silane.
| Compound Name | triethyl(5,7,7-trimethylocta-3,4-dien-3-yl)silane |
|---|---|
| PubChem CID | 164685025 |
| Molecular Formula | C17H34Si |
| Molecular Weight | 266.54 g/mol |
| Exact Mass | 266.24 |
| IUPAC Name | triethyl(5,7,7-trimethylocta-3,4-dien-3-yl)silane |
| SMILES | CCC(=C=C(C)CC(C)(C)C)[Si](CC)(CC)CC |
| InChI | InChI=1S/C17H34Si/c1-9-16(18(10-2,11-3)12-4)13-15(5)14-17(6,7)8/h9-12,14H2,1-8H3 |
| InChIKey | MLULWAHWBUMWLZ-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.54 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|