C16H36OSi2 — CID 91491096
(2-tert-butyl-4,4-dimethylpent-1-enyl)-dimethyl-trimethylsilyloxysilane (PubChem CID 91491096) has the molecular formula C16H36OSi2 and a molecular weight of 300.64 g/mol. Its IUPAC name is (2-tert-butyl-4,4-dimethylpent-1-enyl)-dimethyl-trimethylsilyloxysilane.
| Compound Name | (2-tert-butyl-4,4-dimethylpent-1-enyl)-dimethyl-trimethylsilyloxysilane |
|---|---|
| PubChem CID | 91491096 |
| Molecular Formula | C16H36OSi2 |
| Molecular Weight | 300.64 g/mol |
| Exact Mass | 300.23 |
| IUPAC Name | (2-tert-butyl-4,4-dimethylpent-1-enyl)-dimethyl-trimethylsilyloxysilane |
| SMILES | CC(C)(C)CC(=C[Si](C)(C)O[Si](C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C16H36OSi2/c1-15(2,3)12-14(16(4,5)6)13-19(10,11)17-18(7,8)9/h13H,12H2,1-11H3 |
| InChIKey | PDKYUHATKNNQNJ-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.64 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|