C26H30FNO3 — CID 123251785
tert-butyl 2-cyclopentyl-2-[4-[(4-fluoro-1-hydroxyisoindol-2-yl)methyl]phenyl]acetate (PubChem CID 123251785) has the molecular formula C26H30FNO3 and a molecular weight of 423.53 g/mol. Its IUPAC name is tert-butyl 2-cyclopentyl-2-[4-[(4-fluoro-1-hydroxyisoindol-2-yl)methyl]phenyl]acetate.
| Compound Name | tert-butyl 2-cyclopentyl-2-[4-[(4-fluoro-1-hydroxyisoindol-2-yl)methyl]phenyl]acetate |
|---|---|
| PubChem CID | 123251785 |
| Molecular Formula | C26H30FNO3 |
| Molecular Weight | 423.53 g/mol |
| Exact Mass | 423.22 |
| IUPAC Name | tert-butyl 2-cyclopentyl-2-[4-[(4-fluoro-1-hydroxyisoindol-2-yl)methyl]phenyl]acetate |
| SMILES | CC(C)(C)OC(=O)C(c1ccc(Cn2cc3c(F)cccc3c2O)cc1)C1CCCC1 |
| InChI | InChI=1S/C26H30FNO3/c1-26(2,3)31-25(30)23(18-7-4-5-8-18)19-13-11-17(12-14-19)15-28-16-21-20(24(28)29)9-6-10-22(21)27/h6,9-14,16,18,23,29H,4-5,7-8,15H2,1-3H3 |
| InChIKey | BMOKOBZCMPDNDD-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.53 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |