C17H10F7NO — CID 90893129
5-fluoro-7-(trifluoromethyl)-2-[[4-(trifluoromethyl)phenyl]methyl]isoindol-1-ol (PubChem CID 90893129) has the molecular formula C17H10F7NO and a molecular weight of 377.26 g/mol. Its IUPAC name is 5-fluoro-7-(trifluoromethyl)-2-[[4-(trifluoromethyl)phenyl]methyl]isoindol-1-ol.
| Compound Name | 5-fluoro-7-(trifluoromethyl)-2-[[4-(trifluoromethyl)phenyl]methyl]isoindol-1-ol |
|---|---|
| PubChem CID | 90893129 |
| Molecular Formula | C17H10F7NO |
| Molecular Weight | 377.26 g/mol |
| Exact Mass | 377.07 |
| IUPAC Name | 5-fluoro-7-(trifluoromethyl)-2-[[4-(trifluoromethyl)phenyl]methyl]isoindol-1-ol |
| SMILES | Oc1c2c(C(F)(F)F)cc(F)cc2cn1Cc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H10F7NO/c18-12-5-10-8-25(15(26)14(10)13(6-12)17(22,23)24)7-9-1-3-11(4-2-9)16(19,20)21/h1-6,8,26H,7H2 |
| InChIKey | LDWPACDLYPOELW-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 25.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.26 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |