C42H28N3S+ — CID 123251991
20-(9-phenylcarbazol-3-yl)-11-thia-1-aza-20-azoniaheptacyclo[13.11.1.02,14.04,12.05,10.019,27.021,26]heptacosa-2(14),4,6,8,12,15,17,19,21,23,25-undecaene (PubChem CID 123251991) has the molecular formula C42H28N3S+ and a molecular weight of 606.77 g/mol. Its IUPAC name is 20-(9-phenylcarbazol-3-yl)-11-thia-1-aza-20-azoniaheptacyclo[13.11.1.02,14.04,12.05,10.019,27.021,26]heptacosa-2(14),4,6,8,12,15,17,19,21,23,25-undecaene.
| Compound Name | 20-(9-phenylcarbazol-3-yl)-11-thia-1-aza-20-azoniaheptacyclo[13.11.1.02,14.04,12.05,10.019,27.021,26]heptacosa-2(14),4,6,8,12,15,17,19,21,23,25-undecaene |
|---|---|
| PubChem CID | 123251991 |
| Molecular Formula | C42H28N3S+ |
| Molecular Weight | 606.77 g/mol |
| Exact Mass | 606.20 |
| IUPAC Name | 20-(9-phenylcarbazol-3-yl)-11-thia-1-aza-20-azoniaheptacyclo[13.11.1.02,14.04,12.05,10.019,27.021,26]heptacosa-2(14),4,6,8,12,15,17,19,21,23,25-undecaene |
| SMILES | C1=CC2=C3CC4=C(C=C3SC2C=C1)C1=CC=CC2=[N+](c3ccc5c(c3)c3ccccc3n5-c3ccccc3)c3ccccc3N4C12 |
| InChI | InChI=1S/C42H28N3S/c1-2-11-26(12-3-1)43-34-16-6-4-13-28(34)31-23-27(21-22-35(31)43)44-36-17-7-8-18-37(36)45-39-24-33-29-14-5-9-20-40(29)46-41(33)25-32(39)30-15-10-19-38(44)42(30)45/h1-23,25,40,42H,24H2/q+1 |
| InChIKey | VANQJNQFEMGASJ-UHFFFAOYSA-N |
| XLogP | 9.84 |
| TPSA | 11.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.77 |
| LogP ≤ 5 | 9.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|