C48H33N4+ — CID 123598848
11-(4-carbazol-9-ylphenyl)-20-phenyl-1,11-diaza-20-azoniaheptacyclo[13.11.1.02,14.04,12.05,10.019,27.021,26]heptacosa-2(14),4,6,8,12,15,17,19,21,23,25-undecaene (PubChem CID 123598848) has the molecular formula C48H33N4+ and a molecular weight of 665.82 g/mol. Its IUPAC name is 11-(4-carbazol-9-ylphenyl)-20-phenyl-1,11-diaza-20-azoniaheptacyclo[13.11.1.02,14.04,12.05,10.019,27.021,26]heptacosa-2(14),4,6,8,12,15,17,19,21,23,25-undecaene.
| Compound Name | 11-(4-carbazol-9-ylphenyl)-20-phenyl-1,11-diaza-20-azoniaheptacyclo[13.11.1.02,14.04,12.05,10.019,27.021,26]heptacosa-2(14),4,6,8,12,15,17,19,21,23,25-undecaene |
|---|---|
| PubChem CID | 123598848 |
| Molecular Formula | C48H33N4+ |
| Molecular Weight | 665.82 g/mol |
| Exact Mass | 665.27 |
| IUPAC Name | 11-(4-carbazol-9-ylphenyl)-20-phenyl-1,11-diaza-20-azoniaheptacyclo[13.11.1.02,14.04,12.05,10.019,27.021,26]heptacosa-2(14),4,6,8,12,15,17,19,21,23,25-undecaene |
| SMILES | C1=CC2=C3CC4=C(C=C3N(c3ccc(-n5c6ccccc6c6ccccc65)cc3)C2C=C1)C1=CC=CC2=[N+](c3ccccc3)c3ccccc3N4C12 |
| InChI | InChI=1S/C48H33N4/c1-2-13-31(14-3-1)51-43-22-10-11-23-44(43)52-47-29-38-36-17-6-9-21-42(36)50(46(38)30-39(47)37-18-12-24-45(51)48(37)52)33-27-25-32(26-28-33)49-40-19-7-4-15-34(40)35-16-5-8-20-41(35)49/h1-28,30,42,48H,29H2/q+1 |
| InChIKey | ZGNNVNQZBFNHCA-UHFFFAOYSA-N |
| XLogP | 10.61 |
| TPSA | 14.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.82 |
| LogP ≤ 5 | 10.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|